Products 1404195-16-9
CAS 1404195-16-9 appears in our catalog under these names: 2-(Chlorodifluoromethoxy)-1,3-difluorobenzene, 95%, 2-(Chlorodifluoromethoxy)-1,3-difluorobenzene, 98%, 2–(Chlorodifluoromethoxy)–1，3–difluorobenzene. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 25g.
2-[chloro(difluoro)methoxy]-1,3-difluorobenzene (CAS 1404195-16-9) is a chemical compound with the molecular formula C7H3ClF4O and a molecular weight of 214.54 g/mol. IUPAC name: 2-[chloro(difluoro)methoxy]-1,3-difluorobenzene. InChIKey: WNDDVXHJMJTOSB-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF4O |
|---|---|
| Molecular weight | 214.54 g/mol |
| IUPAC name | 2-[chloro(difluoro)methoxy]-1,3-difluorobenzene |
| InChIKey | WNDDVXHJMJTOSB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)OC(F)(F)Cl)F |
Computed by PubChem (NCBI)