CAS 1285694-84-9 appears in our catalog under these names: 2,4-Bis(4-ethynylphenyl)pyridine, 97%, 2,4–Bis(4–ethynylphenyl)pyridine. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 1g.
2,4-bis(4-ethynylphenyl)pyridine (CAS 1285694-84-9) is a chemical compound with the molecular formula C21H13N and a molecular weight of 279.3 g/mol. IUPAC name: 2,4-bis(4-ethynylphenyl)pyridine. InChIKey: FQFVMZWLIKNDCU-UHFFFAOYSA-N.
| Molecular formula | C21H13N |
|---|---|
| Molecular weight | 279.3 g/mol |
| IUPAC name | 2,4-bis(4-ethynylphenyl)pyridine |
| InChIKey | FQFVMZWLIKNDCU-UHFFFAOYSA-N |
| SMILES | C#CC1=CC=C(C=C1)C2=CC(=NC=C2)C3=CC=C(C=C3)C#C |
Computed by PubChem (NCBI)