CAS 226-92-6 appears in our catalog under these names: Dibenzo[a,i]acridine, 97%, 62935, Dibenz[a,i]acridine (purity). Offered by: Chemat Brand, Sigma-Aldrich. Available pack sizes: on request, 20MG.
13-azapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),2,4,6,8,10,12,14,16,18,20-undecaene (CAS 226-92-6) is a chemical compound with the molecular formula C21H13N and a molecular weight of 279.3 g/mol. IUPAC name: 13-azapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),2,4,6,8,10,12,14,16,18,20-undecaene. InChIKey: MRXMZJQYYWLOCW-UHFFFAOYSA-N.
| Molecular formula | C21H13N |
|---|---|
| Molecular weight | 279.3 g/mol |
| IUPAC name | 13-azapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),2,4,6,8,10,12,14,16,18,20-undecaene |
| InChIKey | MRXMZJQYYWLOCW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=NC4=CC5=CC=CC=C5C=C4C=C32 |
Computed by PubChem (NCBI)