CAS 1286165-14-7 appears in our catalog under these names: Flavoxate Impurity 3 (Flavoxate EP Impurity C), 1-Methylethyl 3-Methyl-4-oxo-2-phenyl-4H-1-benzopyran-8-carboxylate (3-Methylflavone-8-carboxylic Acid Isopropyl Ester). Offered by: Hubei YoungXin, Mikromol. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
Propan-2-yl 3-methyl-4-oxo-2-phenylchromene-8-carboxylate (CAS 1286165-14-7) is a chemical compound with the molecular formula C20H18O4 and a molecular weight of 322.4 g/mol. IUPAC name: propan-2-yl 3-methyl-4-oxo-2-phenylchromene-8-carboxylate. InChIKey: AGGXILIQAJZBJD-UHFFFAOYSA-N.
| Molecular formula | C20H18O4 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | propan-2-yl 3-methyl-4-oxo-2-phenylchromene-8-carboxylate |
| InChIKey | AGGXILIQAJZBJD-UHFFFAOYSA-N |
| SMILES | CC1=C(OC2=C(C1=O)C=CC=C2C(=O)OC(C)C)C3=CC=CC=C3 |
Computed by PubChem (NCBI)