CAS 71367-28-7 appears in our catalog under these names: 3,3'-(Anthracene-9,10-diyl)dipropanoic acid, 95%, 3–(10–(2–Carboxy–Ethyl)–Anthracen–9–Yl)–Propionic Acid, 9,10-Anthracenedipropanoic acid, 3,3'-(Anthracene-9,10-diyl)dipropanoic acid 95%, 9,10-Anthracenedipropanoicacid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Ambeed, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 50mg.
3-[10-(2-carboxyethyl)anthracen-9-yl]propanoic acid (CAS 71367-28-7) is a chemical compound with the molecular formula C20H18O4 and a molecular weight of 322.4 g/mol. IUPAC name: 3-[10-(2-carboxyethyl)anthracen-9-yl]propanoic acid. InChIKey: PHRHANASDXMZLU-UHFFFAOYSA-N.
| Molecular formula | C20H18O4 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | 3-[10-(2-carboxyethyl)anthracen-9-yl]propanoic acid |
| InChIKey | PHRHANASDXMZLU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=C2CCC(=O)O)CCC(=O)O |
Computed by PubChem (NCBI)