CAS 128619-81-8 is the registry number for 6-Iodo-4-methyl-2H-benzo[b][1,4]oxazin-3(4H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-iodo-4-methyl-1,4-benzoxazin-3-one (CAS 128619-81-8) is a chemical compound with the molecular formula C9H8INO2 and a molecular weight of 289.07 g/mol. IUPAC name: 6-iodo-4-methyl-1,4-benzoxazin-3-one. InChIKey: RCSBCGNZIIPAJG-UHFFFAOYSA-N.
| Molecular formula | C9H8INO2 |
|---|---|
| Molecular weight | 289.07 g/mol |
| IUPAC name | 6-iodo-4-methyl-1,4-benzoxazin-3-one |
| InChIKey | RCSBCGNZIIPAJG-UHFFFAOYSA-N |
| SMILES | CN1C(=O)COC2=C1C=C(C=C2)I |
Computed by PubChem (NCBI)