CAS 1823994-33-7 appears in our catalog under these names: 4-(2-Iodophenyl)-1,3-oxazolidin-2-one, 95%, 4-(2-Iodophenyl)-1,3-oxazolidin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-(2-iodophenyl)-1,3-oxazolidin-2-one (CAS 1823994-33-7) is a chemical compound with the molecular formula C9H8INO2 and a molecular weight of 289.07 g/mol. IUPAC name: 4-(2-iodophenyl)-1,3-oxazolidin-2-one. InChIKey: OSIOHODPKPKOOW-UHFFFAOYSA-N.
| Molecular formula | C9H8INO2 |
|---|---|
| Molecular weight | 289.07 g/mol |
| IUPAC name | 4-(2-iodophenyl)-1,3-oxazolidin-2-one |
| InChIKey | OSIOHODPKPKOOW-UHFFFAOYSA-N |
| SMILES | C1C(NC(=O)O1)C2=CC=CC=C2I |
Computed by PubChem (NCBI)