CAS 1286207-20-2 is the registry number for (R)-1-(3-Aminopyrrolidin-1-yl)-2-ethylbutan-1-one hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
1-[(3R)-3-aminopyrrolidin-1-yl]-2-ethylbutan-1-one;hydrochloride (CAS 1286207-20-2) is a chemical compound with the molecular formula C10H21ClN2O and a molecular weight of 220.74 g/mol. IUPAC name: 1-[(3R)-3-aminopyrrolidin-1-yl]-2-ethylbutan-1-one;hydrochloride. InChIKey: YHOZDEOQVHTHKS-SBSPUUFOSA-N.
| Molecular formula | C10H21ClN2O |
|---|---|
| Molecular weight | 220.74 g/mol |
| IUPAC name | 1-[(3R)-3-aminopyrrolidin-1-yl]-2-ethylbutan-1-one;hydrochloride |
| InChIKey | YHOZDEOQVHTHKS-SBSPUUFOSA-N |
| SMILES | CCC(CC)C(=O)N1CC[C@H](C1)N.Cl |
Computed by PubChem (NCBI)