Products 937725-08-1

CAS 937725-08-1 is the registry number for N-Isobutylpiperidine-3-carboxamide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

N-(2-methylpropyl)piperidine-3-carboxamide;hydrochloride (CAS 937725-08-1) is a chemical compound with the molecular formula C10H21ClN2O and a molecular weight of 220.74 g/mol. IUPAC name: N-(2-methylpropyl)piperidine-3-carboxamide;hydrochloride. InChIKey: UXVNPWDLMPGEIL-UHFFFAOYSA-N.

Identity
Molecular formulaC10H21ClN2O
Molecular weight220.74 g/mol
IUPAC nameN-(2-methylpropyl)piperidine-3-carboxamide;hydrochloride
InChIKeyUXVNPWDLMPGEIL-UHFFFAOYSA-N
SMILESCC(C)CNC(=O)C1CCCNC1.Cl

Computed by PubChem (NCBI)