CAS 1286207-25-7 is the registry number for (R)-4-Fluoro-N-(piperidin-3-yl)benzamide hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
4-fluoro-N-[(3R)-piperidin-3-yl]benzamide;hydrochloride (CAS 1286207-25-7) is a chemical compound with the molecular formula C12H16ClFN2O and a molecular weight of 258.72 g/mol. IUPAC name: 4-fluoro-N-[(3R)-piperidin-3-yl]benzamide;hydrochloride. InChIKey: RLHAEKJJAWSDEO-RFVHGSKJSA-N.
| Molecular formula | C12H16ClFN2O |
|---|---|
| Molecular weight | 258.72 g/mol |
| IUPAC name | 4-fluoro-N-[(3R)-piperidin-3-yl]benzamide;hydrochloride |
| InChIKey | RLHAEKJJAWSDEO-RFVHGSKJSA-N |
| SMILES | C1C[C@H](CNC1)NC(=O)C2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)