CAS 1286430-01-0 appears in our catalog under these names: nor-Flurazepam-d4, Desalkylflurazepam-D4 0.1 mg/ml in Methanol, Desalkylflurazepam–d4, Desalkylflurazepam-d4, N-Desalkylflurazepam-d4. Offered by: TRC, LoGiCal, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1ml, 1mg, 5mg, 50mg, 25mg, 1 mg, 100 μg.
7-chloro-5-(2,3,4,5-tetradeuterio-6-fluorophenyl)-1,3-dihydro-1,4-benzodiazepin-2-one (CAS 1286430-01-0) is a chemical compound with the molecular formula C15H10ClFN2O and a molecular weight of 292.73 g/mol. IUPAC name: 7-chloro-5-(2,3,4,5-tetradeuterio-6-fluorophenyl)-1,3-dihydro-1,4-benzodiazepin-2-one. InChIKey: UVCOILFBWYKHHB-RHQRLBAQSA-N.
| Molecular formula | C15H10ClFN2O |
|---|---|
| Molecular weight | 292.73 g/mol |
| IUPAC name | 7-chloro-5-(2,3,4,5-tetradeuterio-6-fluorophenyl)-1,3-dihydro-1,4-benzodiazepin-2-one |
| InChIKey | UVCOILFBWYKHHB-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C2=NCC(=O)NC3=C2C=C(C=C3)Cl)F)[2H])[2H] |
Computed by PubChem (NCBI)