CAS 885277-16-7 is the registry number for 4-Chloro-6-fluoro-2-(4-methoxyphenyl)quinazoline, 98%. Offered by: AmBeed. Available pack sizes: 1g.
4-chloro-6-fluoro-2-(4-methoxyphenyl)quinazoline (CAS 885277-16-7) is a chemical compound with the molecular formula C15H10ClFN2O and a molecular weight of 288.70 g/mol. IUPAC name: 4-chloro-6-fluoro-2-(4-methoxyphenyl)quinazoline. InChIKey: LICKURMOFWYMQR-UHFFFAOYSA-N.
| Molecular formula | C15H10ClFN2O |
|---|---|
| Molecular weight | 288.70 g/mol |
| IUPAC name | 4-chloro-6-fluoro-2-(4-methoxyphenyl)quinazoline |
| InChIKey | LICKURMOFWYMQR-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NC3=C(C=C(C=C3)F)C(=N2)Cl |
Computed by PubChem (NCBI)