CAS 1286490-96-7 is the registry number for 3-Hydroxy-N-desethyl Lidocaine-d5. Offered by: TRC. Available pack sizes: 50mg.
N-(3-hydroxy-2,6-dimethylphenyl)-2-(1,1,2,2,2-pentadeuterioethylamino)acetamide (CAS 1286490-96-7) is a chemical compound with the molecular formula C12H18N2O2 and a molecular weight of 227.31 g/mol. IUPAC name: N-(3-hydroxy-2,6-dimethylphenyl)-2-(1,1,2,2,2-pentadeuterioethylamino)acetamide. InChIKey: YITCMQBVWIHTTA-SGEUAGPISA-N.
| Molecular formula | C12H18N2O2 |
|---|---|
| Molecular weight | 227.31 g/mol |
| IUPAC name | N-(3-hydroxy-2,6-dimethylphenyl)-2-(1,1,2,2,2-pentadeuterioethylamino)acetamide |
| InChIKey | YITCMQBVWIHTTA-SGEUAGPISA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])NCC(=O)NC1=C(C=CC(=C1C)O)C |
Computed by PubChem (NCBI)