Products 1286546-49-3
CAS 1286546-49-3 appears in our catalog under these names: Psilocin-d4 (1.0mg/ml in Acetonitrile), Psilocin-d4. Offered by: TRC. Available pack sizes: 1x1ml, 10mg, 1mg.
3-[1,1,2,2-tetradeuterio-2-(dimethylamino)ethyl]-1H-indol-4-ol (CAS 1286546-49-3) is a chemical compound with the molecular formula C12H16N2O and a molecular weight of 208.29 g/mol. IUPAC name: 3-[1,1,2,2-tetradeuterio-2-(dimethylamino)ethyl]-1H-indol-4-ol. InChIKey: SPCIYGNTAMCTRO-KXGHAPEVSA-N.
| Molecular formula | C12H16N2O |
|---|---|
| Molecular weight | 208.29 g/mol |
| IUPAC name | 3-[1,1,2,2-tetradeuterio-2-(dimethylamino)ethyl]-1H-indol-4-ol |
| InChIKey | SPCIYGNTAMCTRO-KXGHAPEVSA-N |
| SMILES | [2H]C([2H])(C1=CNC2=C1C(=CC=C2)O)C([2H])([2H])N(C)C |
Computed by PubChem (NCBI)