Products 1286632-72-1
CAS 1286632-72-1 appears in our catalog under these names: N-Demethyl Trimebutine-d5 Hydrochloride, >95% (HPLC), N-Demethyl Trimebutine-d5 (hydrochloride). Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
[3,3,4,4,4-pentadeuterio-2-(methylamino)-2-phenylbutyl] 3,4,5-trimethoxybenzoate;hydrochloride (CAS 1286632-72-1) is a chemical compound with the molecular formula C21H28ClNO5 and a molecular weight of 414.9 g/mol. IUPAC name: [3,3,4,4,4-pentadeuterio-2-(methylamino)-2-phenylbutyl] 3,4,5-trimethoxybenzoate;hydrochloride. InChIKey: CTXAQAVYYROYHX-LFMIHFMMSA-N.
| Molecular formula | C21H28ClNO5 |
|---|---|
| Molecular weight | 414.9 g/mol |
| IUPAC name | [3,3,4,4,4-pentadeuterio-2-(methylamino)-2-phenylbutyl] 3,4,5-trimethoxybenzoate;hydrochloride |
| InChIKey | CTXAQAVYYROYHX-LFMIHFMMSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C(COC(=O)C1=CC(=C(C(=C1)OC)OC)OC)(C2=CC=CC=C2)NC.Cl |
Computed by PubChem (NCBI)