CAS 294882-33-0 appears in our catalog under these names: Trimebutine EP Impurity E HCl (N-Desmethyl Trimebutine HCl), N-Demethyl Trimebutine Hydrochloride, >95% (HPLC), (2RS)-2-(Methylamino)-2-phenylbutyl 3,4,5-Trimethoxy-benzoate Hydrochloride (N-Desmethyltrimebutine Hydrochloride), 2-(Methylamino)-2-phenylbutyl 3,4,5-trimethoxybenzoate hydrochloride, 2-(Methylamino)-2-phenylbutyl 3,4,5-trimethoxybenzoate hydrochloride, 95%, 95%. Offered by: Chemat Brand, TRC, Mikromol, Biosynth, Chemat. Available pack sizes: on request, 1mg, 25mg, 5mg, 50mg, 2mg, 10mg, 100mg.
[2-(methylamino)-2-phenylbutyl] 3,4,5-trimethoxybenzoate;hydrochloride (CAS 294882-33-0) is a chemical compound with the molecular formula C21H28ClNO5 and a molecular weight of 409.9 g/mol. IUPAC name: [2-(methylamino)-2-phenylbutyl] 3,4,5-trimethoxybenzoate;hydrochloride. InChIKey: CTXAQAVYYROYHX-UHFFFAOYSA-N.
| Molecular formula | C21H28ClNO5 |
|---|---|
| Molecular weight | 409.9 g/mol |
| IUPAC name | [2-(methylamino)-2-phenylbutyl] 3,4,5-trimethoxybenzoate;hydrochloride |
| InChIKey | CTXAQAVYYROYHX-UHFFFAOYSA-N |
| SMILES | CCC(COC(=O)C1=CC(=C(C(=C1)OC)OC)OC)(C2=CC=CC=C2)NC.Cl |
Computed by PubChem (NCBI)