CAS 1286734-81-3 is the registry number for 3,6-Dibromo-5-fluoro-1h-indazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
3,6-dibromo-5-fluoro-2H-indazole (CAS 1286734-81-3) is a chemical compound with the molecular formula C7H3Br2FN2 and a molecular weight of 293.92 g/mol. IUPAC name: 3,6-dibromo-5-fluoro-2H-indazole. InChIKey: GLGCSECGRMBGOJ-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2FN2 |
|---|---|
| Molecular weight | 293.92 g/mol |
| IUPAC name | 3,6-dibromo-5-fluoro-2H-indazole |
| InChIKey | GLGCSECGRMBGOJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC2=NNC(=C21)Br)Br)F |
Computed by PubChem (NCBI)