CAS 2910928-83-3 is the registry number for 3,6-Dibromo-7-fluoroimidazo[1,2-a]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,6-dibromo-7-fluoroimidazo[1,2-a]pyridine (CAS 2910928-83-3) is a chemical compound with the molecular formula C7H3Br2FN2 and a molecular weight of 293.92 g/mol. IUPAC name: 3,6-dibromo-7-fluoroimidazo[1,2-a]pyridine. InChIKey: REDJTAPKFPYXMD-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2FN2 |
|---|---|
| Molecular weight | 293.92 g/mol |
| IUPAC name | 3,6-dibromo-7-fluoroimidazo[1,2-a]pyridine |
| InChIKey | REDJTAPKFPYXMD-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN2C1=NC=C2Br)Br)F |
Computed by PubChem (NCBI)