CAS 1286768-24-8 is the registry number for (3S)​-3-​Thiomorpholinemethan​ol 1,​1-​dioxide hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[(3S)-1,1-dioxo-1,4-thiazinan-3-yl]methanol;hydrochloride (CAS 1286768-24-8) is a chemical compound with the molecular formula C5H12ClNO3S and a molecular weight of 201.67 g/mol. IUPAC name: [(3S)-1,1-dioxo-1,4-thiazinan-3-yl]methanol;hydrochloride. InChIKey: YOYMVEXPUQFRQH-JEDNCBNOSA-N.
| Molecular formula | C5H12ClNO3S |
|---|---|
| Molecular weight | 201.67 g/mol |
| IUPAC name | [(3S)-1,1-dioxo-1,4-thiazinan-3-yl]methanol;hydrochloride |
| InChIKey | YOYMVEXPUQFRQH-JEDNCBNOSA-N |
| SMILES | C1CS(=O)(=O)C[C@@H](N1)CO.Cl |
Computed by PubChem (NCBI)