CAS 1609401-10-6 appears in our catalog under these names: [Trans-4-methoxy-1,1-dioxidotetrahydro-3-thienyl]amine hydrochloride, 95%, trans-3-Amino-4-methoxytetrahydrothiophene 1,1-dioxide hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 250mg, 1g.
(3S,4S)-4-methoxy-1,1-dioxothiolan-3-amine;hydrochloride (CAS 1609401-10-6) is a chemical compound with the molecular formula C5H12ClNO3S and a molecular weight of 201.67 g/mol. IUPAC name: (3S,4S)-4-methoxy-1,1-dioxothiolan-3-amine;hydrochloride. InChIKey: ZAKKOQKZGDVKGA-TYSVMGFPSA-N.
| Molecular formula | C5H12ClNO3S |
|---|---|
| Molecular weight | 201.67 g/mol |
| IUPAC name | (3S,4S)-4-methoxy-1,1-dioxothiolan-3-amine;hydrochloride |
| InChIKey | ZAKKOQKZGDVKGA-TYSVMGFPSA-N |
| SMILES | CO[C@@H]1CS(=O)(=O)C[C@H]1N.Cl |
Computed by PubChem (NCBI)