Products 1286792-92-4
CAS 1286792-92-4 is the registry number for Ethyl 2-(5-bromo-2-(dimethylamino)phenyl)-2,2-difluoroacetate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
Ethyl 2-[5-bromo-2-(dimethylamino)phenyl]-2,2-difluoroacetate (CAS 1286792-92-4) is a chemical compound with the molecular formula C12H14BrF2NO2 and a molecular weight of 322.15 g/mol. IUPAC name: ethyl 2-[5-bromo-2-(dimethylamino)phenyl]-2,2-difluoroacetate. InChIKey: ICZZLYYALIXYBD-UHFFFAOYSA-N.
| Molecular formula | C12H14BrF2NO2 |
|---|---|
| Molecular weight | 322.15 g/mol |
| IUPAC name | ethyl 2-[5-bromo-2-(dimethylamino)phenyl]-2,2-difluoroacetate |
| InChIKey | ICZZLYYALIXYBD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=C(C=CC(=C1)Br)N(C)C)(F)F |
Computed by PubChem (NCBI)