CAS 2680678-38-8 is the registry number for tert-Butyl (4-bromo-2,5-difluorobenzyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(4-bromo-2,5-difluorophenyl)methyl]carbamate (CAS 2680678-38-8) is a chemical compound with the molecular formula C12H14BrF2NO2 and a molecular weight of 322.15 g/mol. IUPAC name: tert-butyl N-[(4-bromo-2,5-difluorophenyl)methyl]carbamate. InChIKey: AKLYXMVFFXOCLM-UHFFFAOYSA-N.
| Molecular formula | C12H14BrF2NO2 |
|---|---|
| Molecular weight | 322.15 g/mol |
| IUPAC name | tert-butyl N-[(4-bromo-2,5-difluorophenyl)methyl]carbamate |
| InChIKey | AKLYXMVFFXOCLM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CC(=C(C=C1F)Br)F |
Computed by PubChem (NCBI)