Products 1286893-94-4
CAS 1286893-94-4 is the registry number for 1-Methyl-5-nitro-1H-benzimidazole-2-butanoic Acid Ethyl Ester-d3. Offered by: TRC. Available pack sizes: 250mg, 25mg.
Ethyl 4-[5-nitro-1-(trideuteriomethyl)benzimidazol-2-yl]butanoate (CAS 1286893-94-4) is a chemical compound with the molecular formula C14H17N3O4 and a molecular weight of 294.32 g/mol. IUPAC name: ethyl 4-[5-nitro-1-(trideuteriomethyl)benzimidazol-2-yl]butanoate. InChIKey: VJVBGSJZBDBEIF-BMSJAHLVSA-N.
| Molecular formula | C14H17N3O4 |
|---|---|
| Molecular weight | 294.32 g/mol |
| IUPAC name | ethyl 4-[5-nitro-1-(trideuteriomethyl)benzimidazol-2-yl]butanoate |
| InChIKey | VJVBGSJZBDBEIF-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])N1C2=C(C=C(C=C2)[N+](=O)[O-])N=C1CCCC(=O)OCC |
Computed by PubChem (NCBI)