CAS 1286953-05-6 is the registry number for Creatinine-13C4. Offered by: TRC. Available pack sizes: 10mg, 1mg.
2-imino-1-(113C)methyl-(2,4,5-13C3)1,3-diazolidin-4-one (CAS 1286953-05-6) is a chemical compound with the molecular formula C4H7N3O and a molecular weight of 117.089 g/mol. IUPAC name: 2-imino-1-(113C)methyl-(2,4,5-13C3)1,3-diazolidin-4-one. InChIKey: DDRJAANPRJIHGJ-JCDJMFQYSA-N.
| Molecular formula | C4H7N3O |
|---|---|
| Molecular weight | 117.089 g/mol |
| IUPAC name | 2-imino-1-(113C)methyl-(2,4,5-13C3)1,3-diazolidin-4-one |
| InChIKey | DDRJAANPRJIHGJ-JCDJMFQYSA-N |
| SMILES | [13CH3]N1[13CH2][13C](=O)N[13C]1=N |
Computed by PubChem (NCBI)