Products 143827-20-7
CAS 143827-20-7 appears in our catalog under these names: Creatinine-d3, Creatinine-d3, >95% (HPLC), Creatinine-d3 (methyl-d3), 99 atom % D, min 98% Chemical Purity, Creatinine–D3, CREATININE-METHYL-D3, 98 ATOM % D. Offered by: Chemat Brand, TRC, CDN, GLPBio, Biosynth. Available pack sizes: on request, 10mg, 1mg, 2,5mg, 0,1g, 0,05g, 5mg, 2mg.
2-imino-1-(trideuteriomethyl)imidazolidin-4-one (CAS 143827-20-7) is a chemical compound with the molecular formula C4H7N3O and a molecular weight of 116.14 g/mol. IUPAC name: 2-imino-1-(trideuteriomethyl)imidazolidin-4-one. InChIKey: DDRJAANPRJIHGJ-FIBGUPNXSA-N.
| Molecular formula | C4H7N3O |
|---|---|
| Molecular weight | 116.14 g/mol |
| IUPAC name | 2-imino-1-(trideuteriomethyl)imidazolidin-4-one |
| InChIKey | DDRJAANPRJIHGJ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1CC(=O)NC1=N |
Computed by PubChem (NCBI)