CAS 1287189-46-1 is the registry number for Cyazofamid-dessulfonamide-carboxylic Acid. Offered by: TRC. Available pack sizes: 100mg, 10mg.
5-chloro-4-(4-methylphenyl)-1H-imidazole-2-carboxylic acid (CAS 1287189-46-1) is a chemical compound with the molecular formula C11H9ClN2O2 and a molecular weight of 236.65 g/mol. IUPAC name: 5-chloro-4-(4-methylphenyl)-1H-imidazole-2-carboxylic acid. InChIKey: GERHFBATOJZCQY-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2O2 |
|---|---|
| Molecular weight | 236.65 g/mol |
| IUPAC name | 5-chloro-4-(4-methylphenyl)-1H-imidazole-2-carboxylic acid |
| InChIKey | GERHFBATOJZCQY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C(NC(=N2)C(=O)O)Cl |
Computed by PubChem (NCBI)