Products 1287189-46-1

CAS 1287189-46-1 is the registry number for Cyazofamid-dessulfonamide-carboxylic Acid. Offered by: TRC. Available pack sizes: 100mg, 10mg.

Structural formula: {0} (CAS {1})

5-chloro-4-(4-methylphenyl)-1H-imidazole-2-carboxylic acid (CAS 1287189-46-1) is a chemical compound with the molecular formula C11H9ClN2O2 and a molecular weight of 236.65 g/mol. IUPAC name: 5-chloro-4-(4-methylphenyl)-1H-imidazole-2-carboxylic acid. InChIKey: GERHFBATOJZCQY-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9ClN2O2
Molecular weight236.65 g/mol
IUPAC name5-chloro-4-(4-methylphenyl)-1H-imidazole-2-carboxylic acid
InChIKeyGERHFBATOJZCQY-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)C2=C(NC(=N2)C(=O)O)Cl

Computed by PubChem (NCBI)