CAS 128811-38-1 is the registry number for (R)-1-Boc-5-(bromomethyl)pyrrolidin-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl (2R)-2-(bromomethyl)-5-oxopyrrolidine-1-carboxylate (CAS 128811-38-1) is a chemical compound with the molecular formula C10H16BrNO3 and a molecular weight of 278.14 g/mol. IUPAC name: tert-butyl (2R)-2-(bromomethyl)-5-oxopyrrolidine-1-carboxylate. InChIKey: PBCOFGASVWDIPR-SSDOTTSWSA-N.
| Molecular formula | C10H16BrNO3 |
|---|---|
| Molecular weight | 278.14 g/mol |
| IUPAC name | tert-butyl (2R)-2-(bromomethyl)-5-oxopyrrolidine-1-carboxylate |
| InChIKey | PBCOFGASVWDIPR-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@H](CCC1=O)CBr |
Computed by PubChem (NCBI)