Products 171201-54-0
CAS 171201-54-0 is the registry number for tert-Butyl 3-bromo-3-methyl-2-oxopyrrolidine-1-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-bromo-3-methyl-2-oxopyrrolidine-1-carboxylate (CAS 171201-54-0) is a chemical compound with the molecular formula C10H16BrNO3 and a molecular weight of 278.14 g/mol. IUPAC name: tert-butyl 3-bromo-3-methyl-2-oxopyrrolidine-1-carboxylate. InChIKey: YQRICWRYVPGCQG-UHFFFAOYSA-N.
| Molecular formula | C10H16BrNO3 |
|---|---|
| Molecular weight | 278.14 g/mol |
| IUPAC name | tert-butyl 3-bromo-3-methyl-2-oxopyrrolidine-1-carboxylate |
| InChIKey | YQRICWRYVPGCQG-UHFFFAOYSA-N |
| SMILES | CC1(CCN(C1=O)C(=O)OC(C)(C)C)Br |
Computed by PubChem (NCBI)