Products 128899-79-6
CAS 128899-79-6 is the registry number for (S)-4,4,4-Trifluoro-3-hydroxybutyric acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(3S)-4,4,4-trifluoro-3-hydroxybutanoic acid (CAS 128899-79-6) is a chemical compound with the molecular formula C4H5F3O3 and a molecular weight of 158.08 g/mol. IUPAC name: (3S)-4,4,4-trifluoro-3-hydroxybutanoic acid. InChIKey: ASQMUMZEQLWJRC-REOHCLBHSA-N.
| Molecular formula | C4H5F3O3 |
|---|---|
| Molecular weight | 158.08 g/mol |
| IUPAC name | (3S)-4,4,4-trifluoro-3-hydroxybutanoic acid |
| InChIKey | ASQMUMZEQLWJRC-REOHCLBHSA-N |
| SMILES | C([C@@H](C(F)(F)F)O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(3S)-3-Hydroxy-4,4,4-trifluorobutanoic acid, (S)-4,4,4-Trifluoro-3-hydroxybutyric acid, (3S)-4,4,4-trifluoro-3-hydroxybutanoic acid, (S)-4,4,4-Trifluoro-3-hydroxybutanoic Acid, (R)-3-Hydroxy-4,4,4-trifluorobutyric acid, (S)-4,4,4-Trifluoro-3-hydroxybutyricacid, butanoic acid, 4,4,4-trifluoro-3-hydroxy-, (3s)-, ASQMUMZEQLWJRC-REOHCLBHSA-N