Products 164124-07-6

CAS 164124-07-6 is the registry number for 2,2,2-Trifluoroethyl 2-hydroxyacetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,2,2-trifluoroethyl 2-hydroxyacetate (CAS 164124-07-6) is a chemical compound with the molecular formula C4H5F3O3 and a molecular weight of 158.08 g/mol. IUPAC name: 2,2,2-trifluoroethyl 2-hydroxyacetate. InChIKey: NRBMVOHHBGFIOI-UHFFFAOYSA-N.

Identity
Molecular formulaC4H5F3O3
Molecular weight158.08 g/mol
IUPAC name2,2,2-trifluoroethyl 2-hydroxyacetate
InChIKeyNRBMVOHHBGFIOI-UHFFFAOYSA-N
SMILESC(C(=O)OCC(F)(F)F)O

Computed by PubChem (NCBI)