CAS 1289203-63-9 is the registry number for tert-Butyl (5-iodo-2,3-dihydro-1H-inden-2-yl)carbamate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-(5-iodo-2,3-dihydro-1H-inden-2-yl)carbamate (CAS 1289203-63-9) is a chemical compound with the molecular formula C14H18INO2 and a molecular weight of 359.20 g/mol. IUPAC name: tert-butyl N-(5-iodo-2,3-dihydro-1H-inden-2-yl)carbamate. InChIKey: KLDAQKSYKVKMLN-UHFFFAOYSA-N.
| Molecular formula | C14H18INO2 |
|---|---|
| Molecular weight | 359.20 g/mol |
| IUPAC name | tert-butyl N-(5-iodo-2,3-dihydro-1H-inden-2-yl)carbamate |
| InChIKey | KLDAQKSYKVKMLN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CC2=C(C1)C=C(C=C2)I |
Computed by PubChem (NCBI)