CAS 88458-09-7 is the registry number for 1-(2-Carboxyethyl)-2,3,3-trimethyl-3H-indol-1-ium iodide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-(2,3,3-trimethylindol-1-ium-1-yl)propanoic acid iodide (CAS 88458-09-7) is a chemical compound with the molecular formula C14H18INO2 and a molecular weight of 359.20 g/mol. IUPAC name: 3-(2,3,3-trimethylindol-1-ium-1-yl)propanoic acid iodide. InChIKey: PUJHOTSSCDHOJW-UHFFFAOYSA-N.
| Molecular formula | C14H18INO2 |
|---|---|
| Molecular weight | 359.20 g/mol |
| IUPAC name | 3-(2,3,3-trimethylindol-1-ium-1-yl)propanoic acid iodide |
| InChIKey | PUJHOTSSCDHOJW-UHFFFAOYSA-N |
| SMILES | CC1=[N+](C2=CC=CC=C2C1(C)C)CCC(=O)O.[I-] |
Computed by PubChem (NCBI)