CAS 128946-17-8 is the registry number for Ethyl a-D-thiomannopyranoside. Offered by: Biosynth. Available pack sizes: 25g, 10g, 50g.
(2R,3S,4S,5S,6R)-2-ethylsulfanyl-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 128946-17-8) is a chemical compound with the molecular formula C8H16O5S and a molecular weight of 224.28 g/mol. IUPAC name: (2R,3S,4S,5S,6R)-2-ethylsulfanyl-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: CHAHFVCHPSPXOE-QQGCVABSSA-N.
| Molecular formula | C8H16O5S |
|---|---|
| Molecular weight | 224.28 g/mol |
| IUPAC name | (2R,3S,4S,5S,6R)-2-ethylsulfanyl-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | CHAHFVCHPSPXOE-QQGCVABSSA-N |
| SMILES | CCS[C@@H]1[C@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)