CAS 129-06-6 appears in our catalog under these names: (±)-Warfarin Sodium, >95% (HPLC), Warfarin sodium, Warfarin sodium salt, 97.00%, Warfarin Sodium (contains Isopropyl Alcohol), >98.0%(HPLC), 3-(A-ACETONYLBENZYL)-4-HYDROXYCOUMARIN,. Offered by: TRC, GLPBio, Chemat, TCI, Sigma-Aldrich. Available pack sizes: 5g, 500mg, 10g, 25g, 1mg, 1x250mg.
Sodium 2-oxo-3-(3-oxo-1-phenylbutyl)chromen-4-olate (CAS 129-06-6) is a chemical compound with the molecular formula C19H15NaO4 and a molecular weight of 330.3 g/mol. IUPAC name: sodium 2-oxo-3-(3-oxo-1-phenylbutyl)chromen-4-olate. InChIKey: KYITYFHKDODNCQ-UHFFFAOYSA-M.
| Molecular formula | C19H15NaO4 |
|---|---|
| Molecular weight | 330.3 g/mol |
| IUPAC name | sodium 2-oxo-3-(3-oxo-1-phenylbutyl)chromen-4-olate |
| InChIKey | KYITYFHKDODNCQ-UHFFFAOYSA-M |
| SMILES | CC(=O)CC(C1=CC=CC=C1)C2=C(C3=CC=CC=C3OC2=O)[O-].[Na+] |
Computed by PubChem (NCBI)