CAS 67430-45-9 is the registry number for Warfarin Sodium Clathrate. Offered by: Mikromol. Available pack sizes: 250mg.
Sodium 2-oxo-3-(3-oxo-1-phenylbutyl)chromen-4-olate (CAS 67430-45-9) is a chemical compound with the molecular formula C19H15NaO4 and a molecular weight of 330.3 g/mol. IUPAC name: sodium 2-oxo-3-(3-oxo-1-phenylbutyl)chromen-4-olate. InChIKey: KYITYFHKDODNCQ-UHFFFAOYSA-M.
| Molecular formula | C19H15NaO4 |
|---|---|
| Molecular weight | 330.3 g/mol |
| IUPAC name | sodium 2-oxo-3-(3-oxo-1-phenylbutyl)chromen-4-olate |
| InChIKey | KYITYFHKDODNCQ-UHFFFAOYSA-M |
| SMILES | CC(=O)CC(C1=CC=CC=C1)C2=C(C3=CC=CC=C3OC2=O)[O-].[Na+] |
Computed by PubChem (NCBI)