CAS 129-39-5 appears in our catalog under these names: 1,8-Dinitroanthraquinone, >95% (HPLC), 1,8–Dinitroanthraquinone, 1,8-Dinitroanthraquinone, 1,8-Dinitroanthraquinone, 96%, 96%, 1,8-Dinitroanthraquinone, 97.12%. Offered by: TRC, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 1g, 500mg, 10g, 100g, 25g, 50g, 250g.
1,8-dinitroanthracene-9,10-dione (CAS 129-39-5) is a chemical compound with the molecular formula C14H6N2O6 and a molecular weight of 298.21 g/mol. IUPAC name: 1,8-dinitroanthracene-9,10-dione. InChIKey: MBIJFIUDKPXMAV-UHFFFAOYSA-N.
| Molecular formula | C14H6N2O6 |
|---|---|
| Molecular weight | 298.21 g/mol |
| IUPAC name | 1,8-dinitroanthracene-9,10-dione |
| InChIKey | MBIJFIUDKPXMAV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)[N+](=O)[O-])C(=O)C3=C(C2=O)C=CC=C3[N+](=O)[O-] |
Computed by PubChem (NCBI)