CAS 604-94-4 appears in our catalog under these names: 2,7-Dinitro-9,10-phenanthrenedione, 95%, 2,7–dinitrophenanthrene–9,10–dione, 2,7-Dinitrophenanthrene-9,10-dione 97%, 2,7-Dinitro-9,10-phenanthrenedione, 97%, 97%, 2,7-DINITRO-9,10-PHENANTHRENEDIONE, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
2,7-dinitrophenanthrene-9,10-dione (CAS 604-94-4) is a chemical compound with the molecular formula C14H6N2O6 and a molecular weight of 298.21 g/mol. IUPAC name: 2,7-dinitrophenanthrene-9,10-dione. InChIKey: NLYJKDKBQGPHLE-UHFFFAOYSA-N.
| Molecular formula | C14H6N2O6 |
|---|---|
| Molecular weight | 298.21 g/mol |
| IUPAC name | 2,7-dinitrophenanthrene-9,10-dione |
| InChIKey | NLYJKDKBQGPHLE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C(=O)C(=O)C3=C2C=CC(=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)