CAS 129-64-6 appears in our catalog under these names: Carbic Anhydride, cis–5–Norbornene–endo–2,3–dicarboxylic anhydride, cis-5-Norbornene-endo-2,3-dicarboxylic anhydride, 97% , Nadic anhydride, Carbic anhydride 98%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Ambeed. Available pack sizes: 100g, 25g, 5g, 500g, 50g, 250g, 0,25kg, 0,5kg.
(1S,2R,6S,7R)-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (CAS 129-64-6) is a chemical compound with the molecular formula C9H8O3 and a molecular weight of 164.16 g/mol. IUPAC name: (1S,2R,6S,7R)-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione. InChIKey: KNDQHSIWLOJIGP-UMRXKNAASA-N.
| Molecular formula | C9H8O3 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | (1S,2R,6S,7R)-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| InChIKey | KNDQHSIWLOJIGP-UMRXKNAASA-N |
| SMILES | C1[C@@H]2C=C[C@H]1[C@@H]3[C@H]2C(=O)OC3=O |
Computed by PubChem (NCBI)