CAS 2746-19-2 appears in our catalog under these names: cis-Norbornene-exo-2,3-dicarboxylic Anhydride, cis–5–Norbornene–exo–2,3–dicarboxylic anhydride, Cis-5-Norbornene-exo-2,3-dicarboxylic Anhydride/ 99.32% (existing batch purity), cis-5-Norbornene-exo-2,3-dicarboxylic anhydride, 95% , cis-5-Norbornene-exo-2,3-dicarboxylic Anhydride, >97.0%(GC)(T). Offered by: TRC, GLPBio, TargetMol, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 100mg, 1g, 5g, 100g, 500g, 25g, 250g, 1000g.
(1R,2R,6S,7S)-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (CAS 2746-19-2) is a chemical compound with the molecular formula C9H8O3 and a molecular weight of 164.16 g/mol. IUPAC name: (1R,2R,6S,7S)-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione. InChIKey: KNDQHSIWLOJIGP-RNGGSSJXSA-N.
| Molecular formula | C9H8O3 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | (1R,2R,6S,7S)-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| InChIKey | KNDQHSIWLOJIGP-RNGGSSJXSA-N |
| SMILES | C1[C@@H]2C=C[C@H]1[C@H]3[C@@H]2C(=O)OC3=O |
Computed by PubChem (NCBI)