CAS 1290205-03-6 appears in our catalog under these names: (1R)-6-Chloro-3-phenyl-2,3-dihydro-1H-inden-1-yl acetate, 95%, (1R)-6-Chloro-3-phenyl-2,3-dihydro-1H-inden-1-yl acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
[(1R)-6-chloro-3-phenyl-2,3-dihydro-1H-inden-1-yl] acetate (CAS 1290205-03-6) is a chemical compound with the molecular formula C17H15ClO2 and a molecular weight of 286.8 g/mol. IUPAC name: [(1R)-6-chloro-3-phenyl-2,3-dihydro-1H-inden-1-yl] acetate. InChIKey: AKAOHRQUHQBUKN-OMOCHNIRSA-N.
| Molecular formula | C17H15ClO2 |
|---|---|
| Molecular weight | 286.8 g/mol |
| IUPAC name | [(1R)-6-chloro-3-phenyl-2,3-dihydro-1H-inden-1-yl] acetate |
| InChIKey | AKAOHRQUHQBUKN-OMOCHNIRSA-N |
| SMILES | CC(=O)O[C@@H]1CC(C2=C1C=C(C=C2)Cl)C3=CC=CC=C3 |
Computed by PubChem (NCBI)