CAS 129047-05-8 is the registry number for 6-Nitroquipazine Malate Salt. Offered by: TRC. Available pack sizes: 1g.
(Z)-but-2-enedioic acid;6-nitro-2-piperazin-1-ylquinoline (CAS 129047-05-8) is a chemical compound with the molecular formula C17H18N4O6 and a molecular weight of 374.3 g/mol. IUPAC name: (Z)-but-2-enedioic acid;6-nitro-2-piperazin-1-ylquinoline. InChIKey: LXOHMGALVZOYRF-BTJKTKAUSA-N.
| Molecular formula | C17H18N4O6 |
|---|---|
| Molecular weight | 374.3 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;6-nitro-2-piperazin-1-ylquinoline |
| InChIKey | LXOHMGALVZOYRF-BTJKTKAUSA-N |
| SMILES | C1CN(CCN1)C2=NC3=C(C=C2)C=C(C=C3)[N+](=O)[O-].C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)