Products 951950-33-7
CAS 951950-33-7 is the registry number for NAE-IN-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[[2-[[2-[(9-oxo-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-7-yl)oxy]acetyl]amino]acetyl]amino]acetic acid (CAS 951950-33-7) is a chemical compound with the molecular formula C17H18N4O6 and a molecular weight of 374.3 g/mol. IUPAC name: 2-[[2-[[2-[(9-oxo-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-7-yl)oxy]acetyl]amino]acetyl]amino]acetic acid. InChIKey: BGFQHCHLBHLYBO-UHFFFAOYSA-N.
| Molecular formula | C17H18N4O6 |
|---|---|
| Molecular weight | 374.3 g/mol |
| IUPAC name | 2-[[2-[[2-[(9-oxo-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-7-yl)oxy]acetyl]amino]acetyl]amino]acetic acid |
| InChIKey | BGFQHCHLBHLYBO-UHFFFAOYSA-N |
| SMILES | C1CC2=NC3=C(C=C(C=C3)OCC(=O)NCC(=O)NCC(=O)O)C(=O)N2C1 |
Computed by PubChem (NCBI)
Synonyms:
NAE Inhibitor, MLN4924, orb3174295