Products 1290627-70-1
CAS 1290627-70-1 is the registry number for tert-butyl rel-(1R,5R)-6,6-difluoro-3,8-diazabicyclo[3.2.1]octane-8-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (1R,5R)-6,6-difluoro-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (CAS 1290627-70-1) is a chemical compound with the molecular formula C11H18F2N2O2 and a molecular weight of 248.27 g/mol. IUPAC name: tert-butyl (1R,5R)-6,6-difluoro-3,8-diazabicyclo[3.2.1]octane-8-carboxylate. InChIKey: SDBNSVHESWUFQI-HTQZYQBOSA-N.
| Molecular formula | C11H18F2N2O2 |
|---|---|
| Molecular weight | 248.27 g/mol |
| IUPAC name | tert-butyl (1R,5R)-6,6-difluoro-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| InChIKey | SDBNSVHESWUFQI-HTQZYQBOSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC([C@H]1CNC2)(F)F |
Computed by PubChem (NCBI)