CAS 2166191-89-3 is the registry number for tert-Butyl (4r)-3,3-difluoro-1,6-diazaspiro[3.4]octane-6-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg.
Tert-butyl (4R)-3,3-difluoro-1,7-diazaspiro[3.4]octane-7-carboxylate (CAS 2166191-89-3) is a chemical compound with the molecular formula C11H18F2N2O2 and a molecular weight of 248.27 g/mol. IUPAC name: tert-butyl (4R)-3,3-difluoro-1,7-diazaspiro[3.4]octane-7-carboxylate. InChIKey: WDPRNRPYIYPRAN-SNVBAGLBSA-N.
| Molecular formula | C11H18F2N2O2 |
|---|---|
| Molecular weight | 248.27 g/mol |
| IUPAC name | tert-butyl (4R)-3,3-difluoro-1,7-diazaspiro[3.4]octane-7-carboxylate |
| InChIKey | WDPRNRPYIYPRAN-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@]2(C1)C(CN2)(F)F |
Computed by PubChem (NCBI)