CAS 1251000-89-1 is the registry number for tert-Butyl 8,8-difluoro-2,6-diazaspiro[3.4]octane-6-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl 8,8-difluoro-2,6-diazaspiro[3.4]octane-6-carboxylate (CAS 1251000-89-1) is a chemical compound with the molecular formula C11H18F2N2O2 and a molecular weight of 248.27 g/mol. IUPAC name: tert-butyl 8,8-difluoro-2,6-diazaspiro[3.4]octane-6-carboxylate. InChIKey: SHDSDRJLIUSZTR-UHFFFAOYSA-N.
| Molecular formula | C11H18F2N2O2 |
|---|---|
| Molecular weight | 248.27 g/mol |
| IUPAC name | tert-butyl 8,8-difluoro-2,6-diazaspiro[3.4]octane-6-carboxylate |
| InChIKey | SHDSDRJLIUSZTR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(CNC2)C(C1)(F)F |
Computed by PubChem (NCBI)