Products 1290685-35-6
CAS 1290685-35-6 is the registry number for N-Cyclopropyl-N-ethyl-3,5-dimethyl-1H-pyrazole-4-sulfonamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
N-cyclopropyl-N-ethyl-3,5-dimethyl-1H-pyrazole-4-sulfonamide (CAS 1290685-35-6) is a chemical compound with the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. IUPAC name: N-cyclopropyl-N-ethyl-3,5-dimethyl-1H-pyrazole-4-sulfonamide. InChIKey: HCGQLBILLKHEJI-UHFFFAOYSA-N.
| Molecular formula | C10H17N3O2S |
|---|---|
| Molecular weight | 243.33 g/mol |
| IUPAC name | N-cyclopropyl-N-ethyl-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
| InChIKey | HCGQLBILLKHEJI-UHFFFAOYSA-N |
| SMILES | CCN(C1CC1)S(=O)(=O)C2=C(NN=C2C)C |
Computed by PubChem (NCBI)