Products 41893-78-1
CAS 41893-78-1 is the registry number for 3-Amino-4-(diethylamino)benzenesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
3-amino-4-(diethylamino)benzenesulfonamide (CAS 41893-78-1) is a chemical compound with the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. IUPAC name: 3-amino-4-(diethylamino)benzenesulfonamide. InChIKey: IDVXYIQBYRMGDH-UHFFFAOYSA-N.
| Molecular formula | C10H17N3O2S |
|---|---|
| Molecular weight | 243.33 g/mol |
| IUPAC name | 3-amino-4-(diethylamino)benzenesulfonamide |
| InChIKey | IDVXYIQBYRMGDH-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=C(C=C(C=C1)S(=O)(=O)N)N |
Computed by PubChem (NCBI)