CAS 129075-52-1 appears in our catalog under these names: 5-Amino-1,2,3,4-tetrahydroisoquinolin-1-one hydrochloride, 5-Amino-3,4-dihydroisoquinolin-1(2H)-one hydrochloride, 95+%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
5-amino-3,4-dihydro-2H-isoquinolin-1-one;hydrochloride (CAS 129075-52-1) is a chemical compound with the molecular formula C9H11ClN2O and a molecular weight of 198.65 g/mol. IUPAC name: 5-amino-3,4-dihydro-2H-isoquinolin-1-one;hydrochloride. InChIKey: OJFDXKROTLNGGX-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O |
|---|---|
| Molecular weight | 198.65 g/mol |
| IUPAC name | 5-amino-3,4-dihydro-2H-isoquinolin-1-one;hydrochloride |
| InChIKey | OJFDXKROTLNGGX-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C2=C1C(=CC=C2)N.Cl |
Computed by PubChem (NCBI)