CAS 129075-89-4 appears in our catalog under these names: 4-(1H-1,2,3-Benzotriazol-1-ylmethyl)phenylamine, 95%, 4-((1H-Benzo(d)(1,2,3)triazol-1-yl)methyl)aniline, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
4-(benzotriazol-1-ylmethyl)aniline (CAS 129075-89-4) is a chemical compound with the molecular formula C13H12N4 and a molecular weight of 224.26 g/mol. IUPAC name: 4-(benzotriazol-1-ylmethyl)aniline. InChIKey: GJSIHNFDWYIROW-UHFFFAOYSA-N.
| Molecular formula | C13H12N4 |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | 4-(benzotriazol-1-ylmethyl)aniline |
| InChIKey | GJSIHNFDWYIROW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=NN2CC3=CC=C(C=C3)N |
Computed by PubChem (NCBI)