CAS 1398410-73-5 is the registry number for 1,1'-(5-Methyl-1,3-phenylene)bis(1H-imidazole), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3-imidazol-1-yl-5-methylphenyl)imidazole (CAS 1398410-73-5) is a chemical compound with the molecular formula C13H12N4 and a molecular weight of 224.26 g/mol. IUPAC name: 1-(3-imidazol-1-yl-5-methylphenyl)imidazole. InChIKey: HSBLUAWXVOCIGW-UHFFFAOYSA-N.
| Molecular formula | C13H12N4 |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | 1-(3-imidazol-1-yl-5-methylphenyl)imidazole |
| InChIKey | HSBLUAWXVOCIGW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)N2C=CN=C2)N3C=CN=C3 |
Computed by PubChem (NCBI)